About tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate
tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate (PubChem CID 134207617) has the molecular formula C12H26F3NO3S
and a molecular weight of 321.41 g/mol. Its IUPAC name is tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate.
Molecular Properties
| Compound Name | tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate |
| PubChem CID | 134207617 |
| Molecular Formula | C12H26F3NO3S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCC(F)(F)F |
| InChI | InChI=1S/C8H20N.C4H7F3O3S/c1-5-9(6-2,7-3)8-4;5-4(6,7)2-1-3-11(8,9)10/h5-8H2,1-4H3;1-3H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | AEBPSWBCFGIADF-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate?
The IUPAC name of tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate (CID 134207617) is tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate.
What is the SMILES notation for tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate?
The canonical SMILES for tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate is CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCC(F)(F)F.
What is the InChIKey of tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate?
The InChIKey is AEBPSWBCFGIADF-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H7F3O3S/c1-5-9(6-2,7-3)8-4;5-4(6,7)2-1-3-11(8,9)10/h5-8H2,1-4H3;1-3H2,(H,8,9,10)/q+1;/p-1.
What are the key properties of tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate?
tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate has a molecular weight of 321.41 g/mol, XLogP of 2.76, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetraethylazanium;4,4,4-trifluorobutane-1-sulfonate is sourced from PubChem (CID 134207617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).