About 4,4-difluorobutane-1-sulfonate;tetraethylazanium
4,4-difluorobutane-1-sulfonate;tetraethylazanium (PubChem CID 134207634) has the molecular formula C12H27F2NO3S
and a molecular weight of 303.42 g/mol. Its IUPAC name is 4,4-difluorobutane-1-sulfonate;tetraethylazanium.
Molecular Properties
| Compound Name | 4,4-difluorobutane-1-sulfonate;tetraethylazanium |
| PubChem CID | 134207634 |
| Molecular Formula | C12H27F2NO3S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4,4-difluorobutane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCC(F)F |
| InChI | InChI=1S/C8H20N.C4H8F2O3S/c1-5-9(6-2,7-3)8-4;5-4(6)2-1-3-10(7,8)9/h5-8H2,1-4H3;4H,1-3H2,(H,7,8,9)/q+1;/p-1 |
| InChIKey | NXSITKYRRNVDDP-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluorobutane-1-sulfonate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorobutane-1-sulfonate;tetraethylazanium?
The IUPAC name of 4,4-difluorobutane-1-sulfonate;tetraethylazanium (CID 134207634) is 4,4-difluorobutane-1-sulfonate;tetraethylazanium.
What is the SMILES notation for 4,4-difluorobutane-1-sulfonate;tetraethylazanium?
The canonical SMILES for 4,4-difluorobutane-1-sulfonate;tetraethylazanium is CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCC(F)F.
What is the InChIKey of 4,4-difluorobutane-1-sulfonate;tetraethylazanium?
The InChIKey is NXSITKYRRNVDDP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H8F2O3S/c1-5-9(6-2,7-3)8-4;5-4(6)2-1-3-10(7,8)9/h5-8H2,1-4H3;4H,1-3H2,(H,7,8,9)/q+1;/p-1.
What are the key properties of 4,4-difluorobutane-1-sulfonate;tetraethylazanium?
4,4-difluorobutane-1-sulfonate;tetraethylazanium has a molecular weight of 303.42 g/mol, XLogP of 2.46, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorobutane-1-sulfonate;tetraethylazanium is sourced from PubChem (CID 134207634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).