C29H55BrN2O2 — CID 134207666
2-bromo-N-carbamoyl-2-ethylbutanamide;(8E,12E)-8,13-dimethylicosa-8,12-diene (PubChem CID 134207666) has the molecular formula C29H55BrN2O2 and a molecular weight of 543.68 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;(8E,12E)-8,13-dimethylicosa-8,12-diene.
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;(8E,12E)-8,13-dimethylicosa-8,12-diene |
|---|---|
| PubChem CID | 134207666 |
| Molecular Formula | C29H55BrN2O2 |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;(8E,12E)-8,13-dimethylicosa-8,12-diene |
| SMILES | CCC(Br)(CC)C(=O)NC(N)=O.CCCCCCC/C(C)=C/CC/C=C(\C)CCCCCCC |
| InChI | InChI=1S/C22H42.C7H13BrN2O2/c1-5-7-9-11-13-17-21(3)19-15-16-20-22(4)18-14-12-10-8-6-2;1-3-7(8,4-2)5(11)10-6(9)12/h19-20H,5-18H2,1-4H3;3-4H2,1-2H3,(H3,9,10,11,12)/b21-19+,22-20+; |
| InChIKey | YOKJWJZWQIMDAV-ULQNKYRSSA-N |
| XLogP | 9.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|