C19H18N4O2S — CID 134207727
5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide (PubChem CID 134207727) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide.
| Compound Name | 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 134207727 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2sc3c(c(C)cc4nccn43)c2N)cc1 |
| InChI | InChI=1S/C19H18N4O2S/c1-11-9-14-21-7-8-23(14)19-15(11)16(20)17(26-19)18(24)22-10-12-3-5-13(25-2)6-4-12/h3-9H,10,20H2,1-2H3,(H,22,24) |
| InChIKey | XGRUXWNRUTWINB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |