About 8-hexoxy-4,8-dimethylnon-1-en-3-ol
8-hexoxy-4,8-dimethylnon-1-en-3-ol (PubChem CID 134207770) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 8-hexoxy-4,8-dimethylnon-1-en-3-ol.
Molecular Properties
| Compound Name | 8-hexoxy-4,8-dimethylnon-1-en-3-ol |
| PubChem CID | 134207770 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 8-hexoxy-4,8-dimethylnon-1-en-3-ol |
| SMILES | C=CC(O)C(C)CCCC(C)(C)OCCCCCC |
| InChI | InChI=1S/C17H34O2/c1-6-8-9-10-14-19-17(4,5)13-11-12-15(3)16(18)7-2/h7,15-16,18H,2,6,8-14H2,1,3-5H3 |
| InChIKey | RBYURDMNACZMQJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-hexoxy-4,8-dimethylnon-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hexoxy-4,8-dimethylnon-1-en-3-ol?
The IUPAC name of 8-hexoxy-4,8-dimethylnon-1-en-3-ol (CID 134207770) is 8-hexoxy-4,8-dimethylnon-1-en-3-ol.
What is the SMILES notation for 8-hexoxy-4,8-dimethylnon-1-en-3-ol?
The canonical SMILES for 8-hexoxy-4,8-dimethylnon-1-en-3-ol is C=CC(O)C(C)CCCC(C)(C)OCCCCCC.
What is the InChIKey of 8-hexoxy-4,8-dimethylnon-1-en-3-ol?
The InChIKey is RBYURDMNACZMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-6-8-9-10-14-19-17(4,5)13-11-12-15(3)16(18)7-2/h7,15-16,18H,2,6,8-14H2,1,3-5H3.
What are the key properties of 8-hexoxy-4,8-dimethylnon-1-en-3-ol?
8-hexoxy-4,8-dimethylnon-1-en-3-ol has a molecular weight of 270.46 g/mol, XLogP of 4.72, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hexoxy-4,8-dimethylnon-1-en-3-ol is sourced from PubChem (CID 134207770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).