C24H22F2IN5O3 — CID 134208178
4-[3-amino-6-[(3S)-6-oxopiperidin-3-yl]pyrazin-2-yl]-2-fluoro-N-[1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzamide (PubChem CID 134208178) has the molecular formula C24H22F2IN5O3 and a molecular weight of 593.37 g/mol. Its IUPAC name is 4-[3-amino-6-[(3S)-6-oxopiperidin-3-yl]pyrazin-2-yl]-2-fluoro-N-[1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-[3-amino-6-[(3S)-6-oxopiperidin-3-yl]pyrazin-2-yl]-2-fluoro-N-[1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 134208178 |
| Molecular Formula | C24H22F2IN5O3 |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 4-[3-amino-6-[(3S)-6-oxopiperidin-3-yl]pyrazin-2-yl]-2-fluoro-N-[1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzamide |
| SMILES | Nc1ncc([C@H]2CCC(=O)NC2)nc1-c1ccc(C(=O)NC(CO)c2cc(F)cc(I)c2)c(F)c1 |
| InChI | InChI=1S/C24H22F2IN5O3/c25-15-5-14(6-16(27)8-15)20(11-33)32-24(35)17-3-1-12(7-18(17)26)22-23(28)30-10-19(31-22)13-2-4-21(34)29-9-13/h1,3,5-8,10,13,20,33H,2,4,9,11H2,(H2,28,30)(H,29,34)(H,32,35)/t13-,20?/m0/s1 |
| InChIKey | LBDAKVXMQNFHJE-SZQRVLIRSA-N |
| XLogP | 3.07 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|