About 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione
4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione (PubChem CID 13420859) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione.
Molecular Properties
| Compound Name | 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione |
| PubChem CID | 13420859 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione |
| SMILES | CCCC(C)C1OC(=O)C(=O)C1(C)C |
| InChI | InChI=1S/C11H18O3/c1-5-6-7(2)9-11(3,4)8(12)10(13)14-9/h7,9H,5-6H2,1-4H3 |
| InChIKey | PMIJDCFHLSFEFL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione?
The IUPAC name of 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione (CID 13420859) is 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione.
What is the SMILES notation for 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione?
The canonical SMILES for 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione is CCCC(C)C1OC(=O)C(=O)C1(C)C.
What is the InChIKey of 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione?
The InChIKey is PMIJDCFHLSFEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-5-6-7(2)9-11(3,4)8(12)10(13)14-9/h7,9H,5-6H2,1-4H3.
What are the key properties of 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione?
4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione has a molecular weight of 198.26 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-5-pentan-2-yloxolane-2,3-dione is sourced from PubChem (CID 13420859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).