C18H18N4O6S — CID 134208670
3-[2-(2-amino-4-pyridinyl)-5-pyrimidin-5-ylphenyl]propanoic acid;sulfuric acid (PubChem CID 134208670) has the molecular formula C18H18N4O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is 3-[2-(2-amino-4-pyridinyl)-5-pyrimidin-5-ylphenyl]propanoic acid;sulfuric acid.
| Compound Name | 3-[2-(2-amino-4-pyridinyl)-5-pyrimidin-5-ylphenyl]propanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 134208670 |
| Molecular Formula | C18H18N4O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 3-[2-(2-amino-4-pyridinyl)-5-pyrimidin-5-ylphenyl]propanoic acid;sulfuric acid |
| SMILES | Nc1cc(-c2ccc(-c3cncnc3)cc2CCC(=O)O)ccn1.O=S(=O)(O)O |
| InChI | InChI=1S/C18H16N4O2.H2O4S/c19-17-8-14(5-6-22-17)16-3-1-12(15-9-20-11-21-10-15)7-13(16)2-4-18(23)24;1-5(2,3)4/h1,3,5-11H,2,4H2,(H2,19,22)(H,23,24);(H2,1,2,3,4) |
| InChIKey | VIUUBQUEHOWYNZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|