C10H18N2O2 — CID 134209367
4-amino-1-(cyclopropylmethyl)piperidine-3-carboxylic acid (PubChem CID 134209367) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-amino-1-(cyclopropylmethyl)piperidine-3-carboxylic acid.
| Compound Name | 4-amino-1-(cyclopropylmethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134209367 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-amino-1-(cyclopropylmethyl)piperidine-3-carboxylic acid |
| SMILES | NC1CCN(CC2CC2)CC1C(=O)O |
| InChI | InChI=1S/C10H18N2O2/c11-9-3-4-12(5-7-1-2-7)6-8(9)10(13)14/h7-9H,1-6,11H2,(H,13,14) |
| InChIKey | OSZJMVFLJIIGKY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |