About dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate
dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 134209947) has the molecular formula C26H31NO7
and a molecular weight of 469.53 g/mol. Its IUPAC name is dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 134209947 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)CO[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C26H31NO7/c1-26(2,3)34-23(28)18-31-21-14-22(24(29)32-16-19-10-6-4-7-11-19)27(15-21)25(30)33-17-20-12-8-5-9-13-20/h4-13,21-22H,14-18H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | HKHPQFMRIHMKHR-YADHBBJMSA-N |
| XLogP | 3.87 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate?
The IUPAC name of dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate (CID 134209947) is dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)CO[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate?
The InChIKey is HKHPQFMRIHMKHR-YADHBBJMSA-N. The full InChI is InChI=1S/C26H31NO7/c1-26(2,3)34-23(28)18-31-21-14-22(24(29)32-16-19-10-6-4-7-11-19)27(15-21)25(30)33-17-20-12-8-5-9-13-20/h4-13,21-22H,14-18H2,1-3H3/t21-,22+/m1/s1.
What are the key properties of dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate?
dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate has a molecular weight of 469.53 g/mol, XLogP of 3.87, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl (2S,4R)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 134209947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).