C29H34F2N4O4 — CID 134210425
5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(2R,3R)-3-hydroxybutan-2-yl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 134210425) has the molecular formula C29H34F2N4O4 and a molecular weight of 540.61 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(2R,3R)-3-hydroxybutan-2-yl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(2R,3R)-3-hydroxybutan-2-yl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134210425 |
| Molecular Formula | C29H34F2N4O4 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(2R,3R)-3-hydroxybutan-2-yl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | C[C@H]([C@@H](C)O)N1CC[C@@H](NC(=O)c2cc(-c3ccc(F)cc3F)on2)[C@H](C(=O)N(C)CCc2ccccc2)C1 |
| InChI | InChI=1S/C29H34F2N4O4/c1-18(19(2)36)35-14-12-25(23(17-35)29(38)34(3)13-11-20-7-5-4-6-8-20)32-28(37)26-16-27(39-33-26)22-10-9-21(30)15-24(22)31/h4-10,15-16,18-19,23,25,36H,11-14,17H2,1-3H3,(H,32,37)/t18-,19-,23-,25-/m1/s1 |
| InChIKey | BOIHYSKCFPMZJY-AMZPDFMZSA-N |
| XLogP | 3.51 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |