About [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate
[3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate (PubChem CID 134210868) has the molecular formula C11H10BrF2NO5
and a molecular weight of 354.10 g/mol. Its IUPAC name is [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate.
Molecular Properties
| Compound Name | [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate |
| PubChem CID | 134210868 |
| Molecular Formula | C11H10BrF2NO5 |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate |
| SMILES | NC(=O)OCCC(O)c1c(Br)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C11H10BrF2NO5/c12-5-1-2-7-9(20-11(13,14)19-7)8(5)6(16)3-4-18-10(15)17/h1-2,6,16H,3-4H2,(H2,15,17) |
| InChIKey | OUOJYIHTHUFAQZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate?
The IUPAC name of [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate (CID 134210868) is [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate.
What is the SMILES notation for [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate?
The canonical SMILES for [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate is NC(=O)OCCC(O)c1c(Br)ccc2c1OC(F)(F)O2.
What is the InChIKey of [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate?
The InChIKey is OUOJYIHTHUFAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2NO5/c12-5-1-2-7-9(20-11(13,14)19-7)8(5)6(16)3-4-18-10(15)17/h1-2,6,16H,3-4H2,(H2,15,17).
What are the key properties of [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate?
[3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate has a molecular weight of 354.10 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-3-hydroxypropyl] carbamate is sourced from PubChem (CID 134210868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).