C26H39N3O9S — CID 134211435
(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]-1-pentanoyloxypropane-1-sulfonic acid (PubChem CID 134211435) has the molecular formula C26H39N3O9S and a molecular weight of 569.68 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]-1-pentanoyloxypropane-1-sulfonic acid.
| Compound Name | (2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]-1-pentanoyloxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 134211435 |
| Molecular Formula | C26H39N3O9S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | (2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]-1-pentanoyloxypropane-1-sulfonic acid |
| SMILES | CCCCC(=O)OC([C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C26H39N3O9S/c1-4-5-11-22(30)38-25(39(34,35)36)21(15-19-12-13-27-23(19)31)28-24(32)20(14-17(2)3)29-26(33)37-16-18-9-7-6-8-10-18/h6-10,17,19-21,25H,4-5,11-16H2,1-3H3,(H,27,31)(H,28,32)(H,29,33)(H,34,35,36)/t19-,20-,21-,25?/m0/s1 |
| InChIKey | OTFDPOLRAUOHMD-HBZVFYLXSA-N |
| XLogP | 2.29 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|