C22H18ClN9O2S — CID 134211842
8-[(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-3-ethyl-7-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]purine-2,6-dione (PubChem CID 134211842) has the molecular formula C22H18ClN9O2S and a molecular weight of 507.97 g/mol. Its IUPAC name is 8-[(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-3-ethyl-7-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-[(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-3-ethyl-7-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 134211842 |
| Molecular Formula | C22H18ClN9O2S |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 8-[(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-3-ethyl-7-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c1nc(Cc1cn3cc(Cl)sc3n1)n2Cc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C22H18ClN9O2S/c1-2-30-19-18(20(33)28-21(30)34)31(8-13-3-5-15(6-4-13)32-12-24-11-25-32)17(27-19)7-14-9-29-10-16(23)35-22(29)26-14/h3-6,9-12H,2,7-8H2,1H3,(H,28,33,34) |
| InChIKey | VAZSMDMETIFIBH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |