C23H35F — CID 134212732
2-fluoro-1-[(2Z,4Z)-hexa-2,4-dienyl]-4-methyl-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene (PubChem CID 134212732) has the molecular formula C23H35F and a molecular weight of 330.53 g/mol. Its IUPAC name is 2-fluoro-1-[(2Z,4Z)-hexa-2,4-dienyl]-4-methyl-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene.
| Compound Name | 2-fluoro-1-[(2Z,4Z)-hexa-2,4-dienyl]-4-methyl-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134212732 |
| Molecular Formula | C23H35F |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 2-fluoro-1-[(2Z,4Z)-hexa-2,4-dienyl]-4-methyl-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene |
| SMILES | C/C=C\C=C/CC1=C(F)C=C(C)CC1C(C)(C=CCC)C(C)(C)C |
| InChI | InChI=1S/C23H35F/c1-8-10-12-13-14-19-20(16-18(3)17-21(19)24)23(7,15-11-9-2)22(4,5)6/h8,10-13,15,17,20H,9,14,16H2,1-7H3/b10-8-,13-12-,15-11? |
| InChIKey | VZNDQWFYLASAFJ-RXGLXZJNSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|