C20H25N3O4 — CID 134213191
tert-butyl 15-methoxy-12-oxo-2,4,11-triazatricyclo[11.4.0.02,6]heptadeca-1(13),3,5,14,16-pentaene-5-carboxylate (PubChem CID 134213191) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is tert-butyl 15-methoxy-12-oxo-2,4,11-triazatricyclo[11.4.0.02,6]heptadeca-1(13),3,5,14,16-pentaene-5-carboxylate.
| Compound Name | tert-butyl 15-methoxy-12-oxo-2,4,11-triazatricyclo[11.4.0.02,6]heptadeca-1(13),3,5,14,16-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 134213191 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | tert-butyl 15-methoxy-12-oxo-2,4,11-triazatricyclo[11.4.0.02,6]heptadeca-1(13),3,5,14,16-pentaene-5-carboxylate |
| SMILES | COc1ccc2c(c1)C(=O)NCCCCc1c(C(=O)OC(C)(C)C)ncn1-2 |
| InChI | InChI=1S/C20H25N3O4/c1-20(2,3)27-19(25)17-16-7-5-6-10-21-18(24)14-11-13(26-4)8-9-15(14)23(16)12-22-17/h8-9,11-12H,5-7,10H2,1-4H3,(H,21,24) |
| InChIKey | CXRFNPZKJCMCDW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |