About 2-azatricyclo[10.7.1.13,10]henicosan-11-one
2-azatricyclo[10.7.1.13,10]henicosan-11-one (PubChem CID 134213240) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is 2-azatricyclo[10.7.1.13,10]henicosan-11-one.
Molecular Properties
| Compound Name | 2-azatricyclo[10.7.1.13,10]henicosan-11-one |
| PubChem CID | 134213240 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 2-azatricyclo[10.7.1.13,10]henicosan-11-one |
| SMILES | O=C1C2CCCCCCCC(C2)NC2CCCCCCC1C2 |
| InChI | InChI=1S/C20H35NO/c22-20-16-10-6-2-1-3-8-12-18(14-16)21-19-13-9-5-4-7-11-17(20)15-19/h16-19,21H,1-15H2 |
| InChIKey | LNHUEQSQRGKOSD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azatricyclo[10.7.1.13,10]henicosan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azatricyclo[10.7.1.13,10]henicosan-11-one?
The IUPAC name of 2-azatricyclo[10.7.1.13,10]henicosan-11-one (CID 134213240) is 2-azatricyclo[10.7.1.13,10]henicosan-11-one.
What is the SMILES notation for 2-azatricyclo[10.7.1.13,10]henicosan-11-one?
The canonical SMILES for 2-azatricyclo[10.7.1.13,10]henicosan-11-one is O=C1C2CCCCCCCC(C2)NC2CCCCCCC1C2.
What is the InChIKey of 2-azatricyclo[10.7.1.13,10]henicosan-11-one?
The InChIKey is LNHUEQSQRGKOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO/c22-20-16-10-6-2-1-3-8-12-18(14-16)21-19-13-9-5-4-7-11-17(20)15-19/h16-19,21H,1-15H2.
What are the key properties of 2-azatricyclo[10.7.1.13,10]henicosan-11-one?
2-azatricyclo[10.7.1.13,10]henicosan-11-one has a molecular weight of 305.51 g/mol, XLogP of 5.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azatricyclo[10.7.1.13,10]henicosan-11-one is sourced from PubChem (CID 134213240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).