C32H43F2N5O7 — CID 134213355
3-(3,5-difluorophenyl)-N-[(3S,4S,9R,13S,16S)-16-ethyl-4,9,13,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl]propanamide (PubChem CID 134213355) has the molecular formula C32H43F2N5O7 and a molecular weight of 647.72 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-[(3S,4S,9R,13S,16S)-16-ethyl-4,9,13,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl]propanamide.
| Compound Name | 3-(3,5-difluorophenyl)-N-[(3S,4S,9R,13S,16S)-16-ethyl-4,9,13,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl]propanamide |
|---|---|
| PubChem CID | 134213355 |
| Molecular Formula | C32H43F2N5O7 |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-[(3S,4S,9R,13S,16S)-16-ethyl-4,9,13,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl]propanamide |
| SMILES | CC[C@H]1C(=O)N[C@@H](C)C(=O)N2C[C@H](C)CC2C(=O)O[C@@H](C)[C@H](NC(=O)CCc2cc(F)cc(F)c2)C(=O)N2CCCC2C(=O)N1C |
| InChI | InChI=1S/C32H43F2N5O7/c1-6-23-28(41)35-18(3)29(42)39-16-17(2)12-25(39)32(45)46-19(4)27(31(44)38-11-7-8-24(38)30(43)37(23)5)36-26(40)10-9-20-13-21(33)15-22(34)14-20/h13-15,17-19,23-25,27H,6-12,16H2,1-5H3,(H,35,41)(H,36,40)/t17-,18+,19+,23+,24?,25?,27+/m1/s1 |
| InChIKey | LJNPQBXJFICZCB-KUQSHGGUSA-N |
| XLogP | 1.30 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |