C33H32F3N9O — CID 134213413
6-[[(S)-(3-but-3-enyl-1,2-dihydrotriazol-5-yl)-(1-methoxyisoquinolin-5-yl)methyl]amino]-4-[(3,3,3-trifluoro-2,2-dimethylpropyl)amino]quinoline-3,8-dicarbonitrile (PubChem CID 134213413) has the molecular formula C33H32F3N9O and a molecular weight of 627.68 g/mol. Its IUPAC name is 6-[[(S)-(3-but-3-enyl-1,2-dihydrotriazol-5-yl)-(1-methoxyisoquinolin-5-yl)methyl]amino]-4-[(3,3,3-trifluoro-2,2-dimethylpropyl)amino]quinoline-3,8-dicarbonitrile.
| Compound Name | 6-[[(S)-(3-but-3-enyl-1,2-dihydrotriazol-5-yl)-(1-methoxyisoquinolin-5-yl)methyl]amino]-4-[(3,3,3-trifluoro-2,2-dimethylpropyl)amino]quinoline-3,8-dicarbonitrile |
|---|---|
| PubChem CID | 134213413 |
| Molecular Formula | C33H32F3N9O |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 6-[[(S)-(3-but-3-enyl-1,2-dihydrotriazol-5-yl)-(1-methoxyisoquinolin-5-yl)methyl]amino]-4-[(3,3,3-trifluoro-2,2-dimethylpropyl)amino]quinoline-3,8-dicarbonitrile |
| SMILES | C=CCCN1C=C([C@@H](Nc2cc(C#N)c3ncc(C#N)c(NCC(C)(C)C(F)(F)F)c3c2)c2cccc3c(OC)nccc23)NN1 |
| InChI | InChI=1S/C33H32F3N9O/c1-5-6-12-45-18-27(43-44-45)30(24-8-7-9-25-23(24)10-11-39-31(25)46-4)42-22-13-20(15-37)28-26(14-22)29(21(16-38)17-40-28)41-19-32(2,3)33(34,35)36/h5,7-11,13-14,17-18,30,42-44H,1,6,12,19H2,2-4H3,(H,40,41)/t30-/m0/s1 |
| InChIKey | INYGILFJWJHQHR-PMERELPUSA-N |
| XLogP | 6.43 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|