About (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine
(8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine (PubChem CID 134213847) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine.
Molecular Properties
| Compound Name | (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine |
| PubChem CID | 134213847 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine |
| SMILES | C=CC(NC)C(CCC(=C)/C=C\C)NNC |
| InChI | InChI=1S/C13H25N3/c1-6-8-11(3)9-10-13(16-15-5)12(7-2)14-4/h6-8,12-16H,2-3,9-10H2,1,4-5H3/b8-6- |
| InChIKey | IMCKTWGDZUWPFX-VURMDHGXSA-N |
| XLogP | 1.77 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine?
The IUPAC name of (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine (CID 134213847) is (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine.
What is the SMILES notation for (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine?
The canonical SMILES for (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine is C=CC(NC)C(CCC(=C)/C=C\C)NNC.
What is the InChIKey of (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine?
The InChIKey is IMCKTWGDZUWPFX-VURMDHGXSA-N. The full InChI is InChI=1S/C13H25N3/c1-6-8-11(3)9-10-13(16-15-5)12(7-2)14-4/h6-8,12-16H,2-3,9-10H2,1,4-5H3/b8-6-.
What are the key properties of (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine?
(8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine has a molecular weight of 223.36 g/mol, XLogP of 1.77, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z)-N-methyl-4-(2-methylhydrazinyl)-7-methylidenedeca-1,8-dien-3-amine is sourced from PubChem (CID 134213847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).