C12H11N3O3 — CID 134214333
2-hydroxy-5-[(E)-3-pyridin-3-ylprop-2-enylidene]-1,3-diazinane-4,6-dione (PubChem CID 134214333) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-hydroxy-5-[(E)-3-pyridin-3-ylprop-2-enylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 2-hydroxy-5-[(E)-3-pyridin-3-ylprop-2-enylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 134214333 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-hydroxy-5-[(E)-3-pyridin-3-ylprop-2-enylidene]-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(O)NC(=O)C1=C/C=C/c1cccnc1 |
| InChI | InChI=1S/C12H11N3O3/c16-10-9(11(17)15-12(18)14-10)5-1-3-8-4-2-6-13-7-8/h1-7,12,18H,(H,14,16)(H,15,17)/b3-1+,9-5- |
| InChIKey | YTHKIHJOWNWUDS-SJAMCSFMSA-N |
| XLogP | -0.46 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|