C55H71N7O7 — CID 134214855
2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[4-[[4-(2-ethylhexoxycarbonyl)phenyl]carbamoyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 134214855) has the molecular formula C55H71N7O7 and a molecular weight of 942.22 g/mol. Its IUPAC name is 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[4-[[4-(2-ethylhexoxycarbonyl)phenyl]carbamoyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[4-[[4-(2-ethylhexoxycarbonyl)phenyl]carbamoyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 134214855 |
| Molecular Formula | C55H71N7O7 |
| Molecular Weight | 942.22 g/mol |
| Exact Mass | 941.54 |
| IUPAC Name | 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[4-[[4-(2-ethylhexoxycarbonyl)phenyl]carbamoyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(NC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)OCC(CC)CCCC)cc4)nc(Nc4ccc(C(=O)OCC(CC)CCCC)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C55H71N7O7/c1-7-13-16-38(10-4)35-67-50(64)42-21-29-45(30-22-42)56-49(63)41-19-27-46(28-20-41)57-53-60-54(58-47-31-23-43(24-32-47)51(65)68-36-39(11-5)17-14-8-2)62-55(61-53)59-48-33-25-44(26-34-48)52(66)69-37-40(12-6)18-15-9-3/h19-34,38-40H,7-18,35-37H2,1-6H3,(H,56,63)(H3,57,58,59,60,61,62) |
| InChIKey | VSMRWUYOQNPDLS-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.22 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|