About 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol
1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol (PubChem CID 134215177) has the molecular formula C11H11BrF2O3
and a molecular weight of 309.11 g/mol. Its IUPAC name is 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol.
Molecular Properties
| Compound Name | 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol |
| PubChem CID | 134215177 |
| Molecular Formula | C11H11BrF2O3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol |
| SMILES | CCCC(O)c1c(Br)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C11H11BrF2O3/c1-2-3-7(15)9-6(12)4-5-8-10(9)17-11(13,14)16-8/h4-5,7,15H,2-3H2,1H3 |
| InChIKey | YZMVTOCTGREQMM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol?
The IUPAC name of 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol (CID 134215177) is 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol.
What is the SMILES notation for 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol?
The canonical SMILES for 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol is CCCC(O)c1c(Br)ccc2c1OC(F)(F)O2.
What is the InChIKey of 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol?
The InChIKey is YZMVTOCTGREQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2O3/c1-2-3-7(15)9-6(12)4-5-8-10(9)17-11(13,14)16-8/h4-5,7,15H,2-3H2,1H3.
What are the key properties of 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol?
1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol has a molecular weight of 309.11 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)butan-1-ol is sourced from PubChem (CID 134215177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).