C25H35N7O3 — CID 134215492
1-[3-[4-(cyclopropylamino)-5-methanimidoyl-6-[[(3Z,5Z)-6-(methoxyamino)hexa-3,5-dienyl]amino]pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 134215492) has the molecular formula C25H35N7O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1-[3-[4-(cyclopropylamino)-5-methanimidoyl-6-[[(3Z,5Z)-6-(methoxyamino)hexa-3,5-dienyl]amino]pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[3-[4-(cyclopropylamino)-5-methanimidoyl-6-[[(3Z,5Z)-6-(methoxyamino)hexa-3,5-dienyl]amino]pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 134215492 |
| Molecular Formula | C25H35N7O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 1-[3-[4-(cyclopropylamino)-5-methanimidoyl-6-[[(3Z,5Z)-6-(methoxyamino)hexa-3,5-dienyl]amino]pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | [H]/N=C/c1c(NCC/C=C\C=C/NOC)nc(-c2cccc(OCC(O)CNC)c2)nc1NC1CC1 |
| InChI | InChI=1S/C25H35N7O3/c1-27-16-20(33)17-35-21-9-7-8-18(14-21)23-31-24(28-12-5-3-4-6-13-29-34-2)22(15-26)25(32-23)30-19-10-11-19/h3-4,6-9,13-15,19-20,26-27,29,33H,5,10-12,16-17H2,1-2H3,(H2,28,30,31,32)/b4-3-,13-6-,26-15+ |
| InChIKey | PKKQUBGQDQFPKZ-BDSAZQJRSA-N |
| XLogP | 2.70 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|