About 2-methylbutan-2-yl 3-acetamidopropanoate
2-methylbutan-2-yl 3-acetamidopropanoate (PubChem CID 134215822) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-methylbutan-2-yl 3-acetamidopropanoate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 3-acetamidopropanoate |
| PubChem CID | 134215822 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-methylbutan-2-yl 3-acetamidopropanoate |
| SMILES | CCC(C)(C)OC(=O)CCNC(C)=O |
| InChI | InChI=1S/C10H19NO3/c1-5-10(3,4)14-9(13)6-7-11-8(2)12/h5-7H2,1-4H3,(H,11,12) |
| InChIKey | IQTXAJPVPVBBPS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylbutan-2-yl 3-acetamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 3-acetamidopropanoate?
The IUPAC name of 2-methylbutan-2-yl 3-acetamidopropanoate (CID 134215822) is 2-methylbutan-2-yl 3-acetamidopropanoate.
What is the SMILES notation for 2-methylbutan-2-yl 3-acetamidopropanoate?
The canonical SMILES for 2-methylbutan-2-yl 3-acetamidopropanoate is CCC(C)(C)OC(=O)CCNC(C)=O.
What is the InChIKey of 2-methylbutan-2-yl 3-acetamidopropanoate?
The InChIKey is IQTXAJPVPVBBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-5-10(3,4)14-9(13)6-7-11-8(2)12/h5-7H2,1-4H3,(H,11,12).
What are the key properties of 2-methylbutan-2-yl 3-acetamidopropanoate?
2-methylbutan-2-yl 3-acetamidopropanoate has a molecular weight of 201.27 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 3-acetamidopropanoate is sourced from PubChem (CID 134215822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).