C26H32FN9O — CID 134216897
cis-(1S,3R)-N-[(1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethyl]-3-[4-[(1-hydrazinyl-3-methylbut-2-enylidene)amino]-6-methylpyrimidin-2-yl]cyclopentane-1-carboxamide (PubChem CID 134216897) has the molecular formula C26H32FN9O and a molecular weight of 505.60 g/mol. Its IUPAC name is cis-(1S,3R)-N-[(1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethyl]-3-[4-[(1-hydrazinyl-3-methylbut-2-enylidene)amino]-6-methylpyrimidin-2-yl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3R)-N-[(1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethyl]-3-[4-[(1-hydrazinyl-3-methylbut-2-enylidene)amino]-6-methylpyrimidin-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 134216897 |
| Molecular Formula | C26H32FN9O |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | cis-(1S,3R)-N-[(1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethyl]-3-[4-[(1-hydrazinyl-3-methylbut-2-enylidene)amino]-6-methylpyrimidin-2-yl]cyclopentane-1-carboxamide |
| SMILES | CC(C)=C/C(=N\c1cc(C)nc([C@@H]2CC[C@H](C(=O)N[C@@H](C)c3ccc(-n4cc(F)cn4)nc3)C2)n1)NN |
| InChI | InChI=1S/C26H32FN9O/c1-15(2)9-23(35-28)33-22-10-16(3)31-25(34-22)18-5-6-19(11-18)26(37)32-17(4)20-7-8-24(29-12-20)36-14-21(27)13-30-36/h7-10,12-14,17-19H,5-6,11,28H2,1-4H3,(H,32,37)(H,31,33,34,35)/t17-,18+,19-/m0/s1 |
| InChIKey | VDJNVTORNYZJDG-OTWHNJEPSA-N |
| XLogP | 3.73 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|