About N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine
N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine (PubChem CID 134217052) has the molecular formula C14H31N3
and a molecular weight of 241.42 g/mol. Its IUPAC name is N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine.
Molecular Properties
| Compound Name | N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine |
| PubChem CID | 134217052 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine |
| SMILES | C=C(CCCN)NCCCCCCCN(C)C |
| InChI | InChI=1S/C14H31N3/c1-14(10-9-11-15)16-12-7-5-4-6-8-13-17(2)3/h16H,1,4-13,15H2,2-3H3 |
| InChIKey | ZKXZXTWHNATHHY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine?
The IUPAC name of N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine (CID 134217052) is N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine.
What is the SMILES notation for N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine?
The canonical SMILES for N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine is C=C(CCCN)NCCCCCCCN(C)C.
What is the InChIKey of N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine?
The InChIKey is ZKXZXTWHNATHHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N3/c1-14(10-9-11-15)16-12-7-5-4-6-8-13-17(2)3/h16H,1,4-13,15H2,2-3H3.
What are the key properties of N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine?
N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine has a molecular weight of 241.42 g/mol, XLogP of 2.34, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-aminopent-1-en-2-yl)-N',N'-dimethylheptane-1,7-diamine is sourced from PubChem (CID 134217052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).