About 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid
2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid (PubChem CID 134217170) has the molecular formula C28H36N4O3
and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid |
| PubChem CID | 134217170 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CCOCCN(c1cnc(-c2ccccc2)c(-c2ccccc2)n1)C(C)C)CC(=O)O |
| InChI | InChI=1S/C28H36N4O3/c1-21(2)31(20-26(33)34)15-17-35-18-16-32(22(3)4)25-19-29-27(23-11-7-5-8-12-23)28(30-25)24-13-9-6-10-14-24/h5-14,19,21-22H,15-18,20H2,1-4H3,(H,33,34) |
| InChIKey | MSCRXPSOMLBKDZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid?
The IUPAC name of 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid (CID 134217170) is 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid.
What is the SMILES notation for 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid?
The canonical SMILES for 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid is CC(C)N(CCOCCN(c1cnc(-c2ccccc2)c(-c2ccccc2)n1)C(C)C)CC(=O)O.
What is the InChIKey of 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid?
The InChIKey is MSCRXPSOMLBKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N4O3/c1-21(2)31(20-26(33)34)15-17-35-18-16-32(22(3)4)25-19-29-27(23-11-7-5-8-12-23)28(30-25)24-13-9-6-10-14-24/h5-14,19,21-22H,15-18,20H2,1-4H3,(H,33,34).
What are the key properties of 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid?
2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid has a molecular weight of 476.62 g/mol, XLogP of 4.84, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]ethoxy]ethyl-propan-2-ylamino]acetic acid is sourced from PubChem (CID 134217170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).