About tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate
tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate (PubChem CID 134217271) has the molecular formula C25H27N3O2
and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate |
| PubChem CID | 134217271 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1cnc(-c2ccccc2)c(-c2ccccc2)n1)C1CC1 |
| InChI | InChI=1S/C25H27N3O2/c1-25(2,3)30-22(29)17-28(20-14-15-20)21-16-26-23(18-10-6-4-7-11-18)24(27-21)19-12-8-5-9-13-19/h4-13,16,20H,14-15,17H2,1-3H3 |
| InChIKey | XNEIRHXVYNDAHZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate?
The IUPAC name of tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate (CID 134217271) is tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate.
What is the SMILES notation for tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate?
The canonical SMILES for tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate is CC(C)(C)OC(=O)CN(c1cnc(-c2ccccc2)c(-c2ccccc2)n1)C1CC1.
What is the InChIKey of tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate?
The InChIKey is XNEIRHXVYNDAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O2/c1-25(2,3)30-22(29)17-28(20-14-15-20)21-16-26-23(18-10-6-4-7-11-18)24(27-21)19-12-8-5-9-13-19/h4-13,16,20H,14-15,17H2,1-3H3.
What are the key properties of tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate?
tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate has a molecular weight of 401.51 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[cyclopropyl-(5,6-diphenylpyrazin-2-yl)amino]acetate is sourced from PubChem (CID 134217271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).