C24H23BrF6N2OS — CID 134217512
2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 134217512) has the molecular formula C24H23BrF6N2OS and a molecular weight of 581.42 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 134217512 |
| Molecular Formula | C24H23BrF6N2OS |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1cc(C(/C=C/c2ccc(C(=S)NCC(=O)NCC(F)(F)F)c(Br)c2)C(F)(F)F)cc(C)c1C |
| InChI | InChI=1S/C24H23BrF6N2OS/c1-13-8-17(9-14(2)15(13)3)19(24(29,30)31)7-5-16-4-6-18(20(25)10-16)22(35)32-11-21(34)33-12-23(26,27)28/h4-10,19H,11-12H2,1-3H3,(H,32,35)(H,33,34)/b7-5+ |
| InChIKey | GJGHZNNFHPQDRN-FNORWQNLSA-N |
| XLogP | 6.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|