C18H15ClF3N3 — CID 134217651
N-(aminomethylidene)-N'-[4-[(E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methanimidamide (PubChem CID 134217651) has the molecular formula C18H15ClF3N3 and a molecular weight of 365.79 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-[4-[(E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methanimidamide.
| Compound Name | N-(aminomethylidene)-N'-[4-[(E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 134217651 |
| Molecular Formula | C18H15ClF3N3 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(aminomethylidene)-N'-[4-[(E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methanimidamide |
| SMILES | N/C=N/C=N/c1ccc(/C=C/C(c2ccc(Cl)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15ClF3N3/c19-15-6-4-14(5-7-15)17(18(20,21)22)10-3-13-1-8-16(9-2-13)25-12-24-11-23/h1-12,17H,(H2,23,24,25)/b10-3+ |
| InChIKey | VKAOMALNPMCEFC-XCVCLJGOSA-N |
| XLogP | 5.35 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|