C17H11BrF6 — CID 134217727
1-[(E)-4-(3-bromo-4-methylphenyl)-1,1,1-trifluorobut-3-en-2-yl]-2,3,4-trifluorobenzene (PubChem CID 134217727) has the molecular formula C17H11BrF6 and a molecular weight of 409.17 g/mol. Its IUPAC name is 1-[(E)-4-(3-bromo-4-methylphenyl)-1,1,1-trifluorobut-3-en-2-yl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[(E)-4-(3-bromo-4-methylphenyl)-1,1,1-trifluorobut-3-en-2-yl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 134217727 |
| Molecular Formula | C17H11BrF6 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 1-[(E)-4-(3-bromo-4-methylphenyl)-1,1,1-trifluorobut-3-en-2-yl]-2,3,4-trifluorobenzene |
| SMILES | Cc1ccc(/C=C/C(c2ccc(F)c(F)c2F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C17H11BrF6/c1-9-2-3-10(8-13(9)18)4-6-12(17(22,23)24)11-5-7-14(19)16(21)15(11)20/h2-8,12H,1H3/b6-4+ |
| InChIKey | DXKSBHRJIFHWIW-GQCTYLIASA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|