C19H16Cl2F3N3S — CID 134217772
methyl (NZ)-N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]carbamimidothioate (PubChem CID 134217772) has the molecular formula C19H16Cl2F3N3S and a molecular weight of 446.33 g/mol. Its IUPAC name is methyl (NZ)-N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]carbamimidothioate.
| Compound Name | methyl (NZ)-N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 134217772 |
| Molecular Formula | C19H16Cl2F3N3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | methyl (NZ)-N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]carbamimidothioate |
| SMILES | CSC(/N=C\N)=N\c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16Cl2F3N3S/c1-28-18(26-11-25)27-16-5-2-12(3-6-16)4-7-17(19(22,23)24)13-8-14(20)10-15(21)9-13/h2-11,17H,1H3,(H2,25,26,27)/b7-4+ |
| InChIKey | QTSZYRLRQSXWCJ-QPJJXVBHSA-N |
| XLogP | 6.69 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|