C23H20BrF7N2O2 — CID 134217774
2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide (PubChem CID 134217774) has the molecular formula C23H20BrF7N2O2 and a molecular weight of 569.31 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 134217774 |
| Molecular Formula | C23H20BrF7N2O2 |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(C(/C=C/c2ccc(C(=O)NCC(=O)NCC(F)(F)F)c(Br)c2)C(F)(F)F)cc(C)c1F |
| InChI | InChI=1S/C23H20BrF7N2O2/c1-12-7-15(8-13(2)20(12)25)17(23(29,30)31)6-4-14-3-5-16(18(24)9-14)21(35)32-10-19(34)33-11-22(26,27)28/h3-9,17H,10-11H2,1-2H3,(H,32,35)(H,33,34)/b6-4+ |
| InChIKey | GEHCTPHCYVXOCN-GQCTYLIASA-N |
| XLogP | 5.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |