C19H13Cl3F3N5 — CID 134217877
N'-[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide (PubChem CID 134217877) has the molecular formula C19H13Cl3F3N5 and a molecular weight of 474.70 g/mol. Its IUPAC name is N'-[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide.
| Compound Name | N'-[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide |
|---|---|
| PubChem CID | 134217877 |
| Molecular Formula | C19H13Cl3F3N5 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | N'-[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide |
| SMILES | N#Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1/N=C/N=C(N)N |
| InChI | InChI=1S/C19H13Cl3F3N5/c20-14-6-11(7-15(21)17(14)22)13(19(23,24)25)3-1-10-2-4-16(12(5-10)8-26)29-9-30-18(27)28/h1-7,9,13H,(H4,27,28,29,30)/b3-1+ |
| InChIKey | YCIQUJAGZAOQDJ-HNQUOIGGSA-N |
| XLogP | 5.81 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|