About 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine
1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine (PubChem CID 134218252) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine.
Molecular Properties
| Compound Name | 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine |
| PubChem CID | 134218252 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(/C=C\C)NN(C)C |
| InChI | InChI=1S/C7H14N2/c1-5-6-7(2)8-9(3)4/h5-6,8H,2H2,1,3-4H3/b6-5- |
| InChIKey | FUGUYAIUQRTNLY-WAYWQWQTSA-N |
| XLogP | 1.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine?
The IUPAC name of 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine (CID 134218252) is 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine.
What is the SMILES notation for 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine?
The canonical SMILES for 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine is C=C(/C=C\C)NN(C)C.
What is the InChIKey of 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine?
The InChIKey is FUGUYAIUQRTNLY-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H14N2/c1-5-6-7(2)8-9(3)4/h5-6,8H,2H2,1,3-4H3/b6-5-.
What are the key properties of 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine?
1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine has a molecular weight of 126.20 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]hydrazine is sourced from PubChem (CID 134218252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).