C24H51N — CID 134218296
7-methyl-N-(3,3,5-trimethylheptan-2-yl)tridecan-7-amine (PubChem CID 134218296) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is 7-methyl-N-(3,3,5-trimethylheptan-2-yl)tridecan-7-amine.
| Compound Name | 7-methyl-N-(3,3,5-trimethylheptan-2-yl)tridecan-7-amine |
|---|---|
| PubChem CID | 134218296 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | 7-methyl-N-(3,3,5-trimethylheptan-2-yl)tridecan-7-amine |
| SMILES | CCCCCCC(C)(CCCCCC)NC(C)C(C)(C)CC(C)CC |
| InChI | InChI=1S/C24H51N/c1-9-12-14-16-18-24(8,19-17-15-13-10-2)25-22(5)23(6,7)20-21(4)11-3/h21-22,25H,9-20H2,1-8H3 |
| InChIKey | RXSAPMXHSSOXCS-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|