C30H35F6N3O4 — CID 134218506
1-[[(10S)-10-hydroxy-7-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoyl]-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide (PubChem CID 134218506) has the molecular formula C30H35F6N3O4 and a molecular weight of 615.62 g/mol. Its IUPAC name is 1-[[(10S)-10-hydroxy-7-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoyl]-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide.
| Compound Name | 1-[[(10S)-10-hydroxy-7-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoyl]-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134218506 |
| Molecular Formula | C30H35F6N3O4 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 1-[[(10S)-10-hydroxy-7-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoyl]-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cn(C[C@]2(O)CCN(C(=O)C(CC(F)(F)F)CC(F)(F)F)CC23CCCC3)c(=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C30H35F6N3O4/c1-37(2)26(42)23-17-39(24(40)14-22(23)20-8-4-3-5-9-20)19-28(43)12-13-38(18-27(28)10-6-7-11-27)25(41)21(15-29(31,32)33)16-30(34,35)36/h3-5,8-9,14,17,21,43H,6-7,10-13,15-16,18-19H2,1-2H3/t28-/m1/s1 |
| InChIKey | SNCGXAOBCQGOIF-MUUNZHRXSA-N |
| XLogP | 5.26 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |