C23H19F3N6O5S — CID 134219146
2-amino-N-[[3-(pyridin-2-ylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide (PubChem CID 134219146) has the molecular formula C23H19F3N6O5S and a molecular weight of 548.50 g/mol. Its IUPAC name is 2-amino-N-[[3-(pyridin-2-ylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide.
| Compound Name | 2-amino-N-[[3-(pyridin-2-ylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 134219146 |
| Molecular Formula | C23H19F3N6O5S |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 2-amino-N-[[3-(pyridin-2-ylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
| SMILES | Nc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1C(=O)N(N)Cc1nc(CS(=O)(=O)c2ccccn2)no1 |
| InChI | InChI=1S/C23H19F3N6O5S/c24-23(25,26)36-16-7-4-14(5-8-16)15-6-9-18(27)17(11-15)22(33)32(28)12-20-30-19(31-37-20)13-38(34,35)21-3-1-2-10-29-21/h1-11H,12-13,27-28H2 |
| InChIKey | LGCMCRWXSQNCFM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|