About methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate
methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate (PubChem CID 134219349) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate.
Molecular Properties
| Compound Name | methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate |
| PubChem CID | 134219349 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate |
| SMILES | COC(=O)CCCCc1ccc2c(n1)NCC=C2 |
| InChI | InChI=1S/C14H18N2O2/c1-18-13(17)7-3-2-6-12-9-8-11-5-4-10-15-14(11)16-12/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,15,16) |
| InChIKey | ZTNCLACEEMWWRE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate?
The IUPAC name of methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate (CID 134219349) is methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate.
What is the SMILES notation for methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate?
The canonical SMILES for methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate is COC(=O)CCCCc1ccc2c(n1)NCC=C2.
What is the InChIKey of methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate?
The InChIKey is ZTNCLACEEMWWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-18-13(17)7-3-2-6-12-9-8-11-5-4-10-15-14(11)16-12/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,15,16).
What are the key properties of methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate?
methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate has a molecular weight of 246.31 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(7,8-dihydro-1,8-naphthyridin-2-yl)pentanoate is sourced from PubChem (CID 134219349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).