C10H11F2IN6S — CID 134219380
[4-[(3,3-difluoropiperidin-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl] thiohypoiodite (PubChem CID 134219380) has the molecular formula C10H11F2IN6S and a molecular weight of 412.21 g/mol. Its IUPAC name is [4-[(3,3-difluoropiperidin-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl] thiohypoiodite.
| Compound Name | [4-[(3,3-difluoropiperidin-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 134219380 |
| Molecular Formula | C10H11F2IN6S |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | [4-[(3,3-difluoropiperidin-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl] thiohypoiodite |
| SMILES | FC1(F)CNCCC1Nc1ncnc2c1cnn2SI |
| InChI | InChI=1S/C10H11F2IN6S/c11-10(12)4-14-2-1-7(10)18-8-6-3-17-19(20-13)9(6)16-5-15-8/h3,5,7,14H,1-2,4H2,(H,15,16,18) |
| InChIKey | BMYHRVSAWHCGBM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|