About N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine
N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine (PubChem CID 134219453) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine |
| PubChem CID | 134219453 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine |
| SMILES | COC1C=CC=CC1CNC(C)C |
| InChI | InChI=1S/C11H19NO/c1-9(2)12-8-10-6-4-5-7-11(10)13-3/h4-7,9-12H,8H2,1-3H3 |
| InChIKey | AFSNAPWUJVQMLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine?
The IUPAC name of N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine (CID 134219453) is N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine.
What is the SMILES notation for N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine?
The canonical SMILES for N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine is COC1C=CC=CC1CNC(C)C.
What is the InChIKey of N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine?
The InChIKey is AFSNAPWUJVQMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-9(2)12-8-10-6-4-5-7-11(10)13-3/h4-7,9-12H,8H2,1-3H3.
What are the key properties of N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine?
N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine has a molecular weight of 181.28 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-methoxycyclohexa-2,4-dien-1-yl)methyl]propan-2-amine is sourced from PubChem (CID 134219453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).