C20H30N4O2 — CID 134219911
N-[(2S)-2-[[(Z)-2-(dimethylamino)but-2-enoyl]-methylamino]cyclohexyl]-N-methylpyridine-2-carboxamide (PubChem CID 134219911) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[(2S)-2-[[(Z)-2-(dimethylamino)but-2-enoyl]-methylamino]cyclohexyl]-N-methylpyridine-2-carboxamide.
| Compound Name | N-[(2S)-2-[[(Z)-2-(dimethylamino)but-2-enoyl]-methylamino]cyclohexyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 134219911 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[(2S)-2-[[(Z)-2-(dimethylamino)but-2-enoyl]-methylamino]cyclohexyl]-N-methylpyridine-2-carboxamide |
| SMILES | C/C=C(/C(=O)N(C)[C@H]1CCCCC1N(C)C(=O)c1ccccn1)N(C)C |
| InChI | InChI=1S/C20H30N4O2/c1-6-16(22(2)3)20(26)24(5)18-13-8-7-12-17(18)23(4)19(25)15-11-9-10-14-21-15/h6,9-11,14,17-18H,7-8,12-13H2,1-5H3/b16-6-/t17?,18-/m0/s1 |
| InChIKey | QQIHRUYLDYYTSB-CVKDMBEPSA-N |
| XLogP | 2.39 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|