About 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene
5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene (PubChem CID 134221136) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 134221136 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene |
| SMILES | Cc1ccc2c(c1Cl)C(C)COC2 |
| InChI | InChI=1S/C11H13ClO/c1-7-3-4-9-6-13-5-8(2)10(9)11(7)12/h3-4,8H,5-6H2,1-2H3 |
| InChIKey | JHWHWNQROULXST-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The IUPAC name of 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene (CID 134221136) is 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene is Cc1ccc2c(c1Cl)C(C)COC2.
What is the InChIKey of 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The InChIKey is JHWHWNQROULXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-7-3-4-9-6-13-5-8(2)10(9)11(7)12/h3-4,8H,5-6H2,1-2H3.
What are the key properties of 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene?
5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene has a molecular weight of 196.68 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4,6-dimethyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 134221136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).