C13H18O5 — CID 13422120
6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromene-3,4-diol (PubChem CID 13422120) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromene-3,4-diol.
| Compound Name | 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromene-3,4-diol |
|---|---|
| PubChem CID | 13422120 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromene-3,4-diol |
| SMILES | COc1cc2c(cc1OC)C(O)C(O)C(C)(C)O2 |
| InChI | InChI=1S/C13H18O5/c1-13(2)12(15)11(14)7-5-9(16-3)10(17-4)6-8(7)18-13/h5-6,11-12,14-15H,1-4H3 |
| InChIKey | KDBPMZIJPQTMCF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |