About N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine
N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine (PubChem CID 134221221) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine |
| PubChem CID | 134221221 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1c2ccccc2COC1C |
| InChI | InChI=1S/C14H21NO/c1-3-8-15-9-14-11(2)16-10-12-6-4-5-7-13(12)14/h4-7,11,14-15H,3,8-10H2,1-2H3 |
| InChIKey | SQGNQPWFZANCJE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine?
The IUPAC name of N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine (CID 134221221) is N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine is CCCNCC1c2ccccc2COC1C.
What is the InChIKey of N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine?
The InChIKey is SQGNQPWFZANCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-3-8-15-9-14-11(2)16-10-12-6-4-5-7-13(12)14/h4-7,11,14-15H,3,8-10H2,1-2H3.
What are the key properties of N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine?
N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine has a molecular weight of 219.33 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-3,4-dihydro-1H-isochromen-4-yl)methyl]propan-1-amine is sourced from PubChem (CID 134221221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).