C12H18O — CID 134221245
(3S,4S)-3,4,7-trimethyl-3,4,4a,8a-tetrahydro-1H-isochromene (PubChem CID 134221245) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (3S,4S)-3,4,7-trimethyl-3,4,4a,8a-tetrahydro-1H-isochromene.
| Compound Name | (3S,4S)-3,4,7-trimethyl-3,4,4a,8a-tetrahydro-1H-isochromene |
|---|---|
| PubChem CID | 134221245 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3S,4S)-3,4,7-trimethyl-3,4,4a,8a-tetrahydro-1H-isochromene |
| SMILES | CC1=CC2CO[C@@H](C)[C@@H](C)C2C=C1 |
| InChI | InChI=1S/C12H18O/c1-8-4-5-12-9(2)10(3)13-7-11(12)6-8/h4-6,9-12H,7H2,1-3H3/t9-,10+,11?,12?/m1/s1 |
| InChIKey | RWNFTZLORGTHKD-QKEWWQLBSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |