About (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene
(4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene (PubChem CID 134221484) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 134221484 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene |
| SMILES | Cc1ccc2c(c1)[C@H](C)COC2 |
| InChI | InChI=1S/C11H14O/c1-8-3-4-10-7-12-6-9(2)11(10)5-8/h3-5,9H,6-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | AKWNVPNBRJYMKE-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The IUPAC name of (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene (CID 134221484) is (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene is Cc1ccc2c(c1)[C@H](C)COC2.
What is the InChIKey of (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene?
The InChIKey is AKWNVPNBRJYMKE-SECBINFHSA-N. The full InChI is InChI=1S/C11H14O/c1-8-3-4-10-7-12-6-9(2)11(10)5-8/h3-5,9H,6-7H2,1-2H3/t9-/m1/s1.
What are the key properties of (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene?
(4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene has a molecular weight of 162.23 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,6-dimethyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 134221484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).