C18H27NO2 — CID 134221507
1-[(3Z,4E)-3-methoxyimino-4-(4-methylpentylidene)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 134221507) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[(3Z,4E)-3-methoxyimino-4-(4-methylpentylidene)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3Z,4E)-3-methoxyimino-4-(4-methylpentylidene)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 134221507 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-[(3Z,4E)-3-methoxyimino-4-(4-methylpentylidene)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CO/N=C1/C=C(C(=O)C(C)(C)C)C=C/C1=C\CCC(C)C |
| InChI | InChI=1S/C18H27NO2/c1-13(2)8-7-9-14-10-11-15(12-16(14)19-21-6)17(20)18(3,4)5/h9-13H,7-8H2,1-6H3/b14-9+,19-16- |
| InChIKey | BBIYLYLUIKEGHZ-DEKNBCERSA-N |
| XLogP | 4.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|