About 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea
1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea (PubChem CID 134221738) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea.
Molecular Properties
| Compound Name | 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea |
| PubChem CID | 134221738 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea |
| SMILES | C=N/C=C\N(C)C(=S)N(C)/C=C\N=C |
| InChI | InChI=1S/C9H14N4S/c1-10-5-7-12(3)9(14)13(4)8-6-11-2/h5-8H,1-2H2,3-4H3/b7-5-,8-6- |
| InChIKey | PQWBTIMWIAEILI-SFECMWDFSA-N |
| XLogP | 1.48 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea?
The IUPAC name of 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea (CID 134221738) is 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea.
What is the SMILES notation for 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea?
The canonical SMILES for 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea is C=N/C=C\N(C)C(=S)N(C)/C=C\N=C.
What is the InChIKey of 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea?
The InChIKey is PQWBTIMWIAEILI-SFECMWDFSA-N. The full InChI is InChI=1S/C9H14N4S/c1-10-5-7-12(3)9(14)13(4)8-6-11-2/h5-8H,1-2H2,3-4H3/b7-5-,8-6-.
What are the key properties of 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea?
1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea has a molecular weight of 210.31 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,3-bis[(Z)-2-(methylideneamino)ethenyl]thiourea is sourced from PubChem (CID 134221738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).